| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:42 UTC |
|---|
| Update Date | 2025-03-21 18:04:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052103 |
|---|
| Frequency | 71.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13NO8S |
|---|
| Molecular Mass | 271.0362 |
|---|
| SMILES | CC(=O)NC1OC(COS(=O)(=O)O)C(O)C1O |
|---|
| InChI Key | FYXZYWSUVRQAEE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetamidesalkyl sulfatescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupmonosaccharidecarboxylic acid derivativesaccharideorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamide1,2-diolalcoholtetrahydrofurancarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
