| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:43 UTC |
|---|
| Update Date | 2025-03-21 18:04:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052129 |
|---|
| Frequency | 62.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H22N2O2 |
|---|
| Molecular Mass | 250.1681 |
|---|
| SMILES | CCN(CC)CCCOC(=O)c1ccc(N)cc1 |
|---|
| InChI Key | IGYSCUBTDYKFBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acid esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminestrialkylamines |
|---|
| Substituents | amino acid or derivativestertiary aliphatic aminebenzoylbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
