| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:49 UTC |
|---|
| Update Date | 2025-03-21 18:04:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052392 |
|---|
| Frequency | 62.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H14N6O3 |
|---|
| Molecular Mass | 218.1127 |
|---|
| SMILES | N=C(N)NC(=N)NOCCC(N)C(=O)O |
|---|
| InChI Key | GEPITIRWQDCVPC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | biguanidescarbonyl compoundscarboximidamidescarboxylic acidsfatty acids and conjugateshydrocarbon derivativesiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsshort-chain hydroxy acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidguanidineiminefatty acidcarboximidamideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundbiguanideorganooxygen compound |
|---|
