| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:50 UTC |
|---|
| Update Date | 2025-03-21 18:04:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052426 |
|---|
| Frequency | 62.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8N2O2 |
|---|
| Molecular Mass | 176.0586 |
|---|
| SMILES | NC(=O)c1c[nH]c2ccc(O)cc12 |
|---|
| InChI Key | CENZODOLKBSOPH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indolecarboxylic acids and derivatives |
|---|
| Direct Parent | indolecarboxamides and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesindolesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amidespyrrole carboxamidesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amideindolecarboxamide derivativepyrrole-3-carboxylic acid or derivativesindole1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyrrole-3-carboxamideorganopnictogen compoundvinylogous amideazacycleheteroaromatic compoundcarboxamide grouporganic oxygen compoundpyrrolehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
