| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:51 UTC |
|---|
| Update Date | 2025-03-21 18:04:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052442 |
|---|
| Frequency | 62.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H35ClN2O3 |
|---|
| Molecular Mass | 506.2336 |
|---|
| SMILES | COc1ccc(C(CCN2CCC(O)(c3ccc(Cl)cc3)CC2)(C(=O)N(C)C)c2ccccc2)cc1 |
|---|
| InChI Key | BFMJHGBWAMBFMT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylmethanes |
|---|
| Direct Parent | diphenylmethanes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeschlorobenzeneshydrocarbon derivativesmethoxybenzenesn-acyl aminesorganic oxidesorganochloridesorganopnictogen compoundsphenoxy compoundsphenylacetamidesphenylpiperidinestertiary alcoholstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | diphenylmethanephenol ethercarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinephenylacetamidetertiary amineorganoheterocyclic compoundaryl chloridechlorobenzenealcoholazacycletertiary aliphatic aminecarboxamide groupmethoxybenzenen-acyl-aminearyl halidetertiary alcoholorganic oxygen compoundphenylpiperidineanisolehydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundamineorganooxygen compound |
|---|
