| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:51 UTC |
|---|
| Update Date | 2025-03-21 18:04:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052454 |
|---|
| Frequency | 62.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H10O6 |
|---|
| Molecular Mass | 238.0477 |
|---|
| SMILES | O=C1CCC(C(=O)c2c(O)cc(O)cc2O)O1 |
|---|
| InChI Key | KIGPYSDSPFPDLP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalpha-acyloxy ketonesaryl alkyl ketonesbenzoyl derivativescarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundstetrahydrofuransvinylogous acids |
|---|
| Substituents | monocyclic benzene moietyaryl alkyl ketonealpha-acyloxy ketonearomatic heteromonocyclic compoundbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativelactonephloroglucinol derivativeorganic oxideorganoheterocyclic compoundacylphloroglucinol derivativetetrahydrofuranbenzenetriol1-hydroxy-4-unsubstituted benzenoidgamma butyrolactoneoxacyclevinylogous acidmonocarboxylic acid or derivativescarboxylic acid esterphenolhydrocarbon derivativebenzenoidalkyl-phenylketone |
|---|