| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:52 UTC |
|---|
| Update Date | 2025-03-21 18:04:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052483 |
|---|
| Frequency | 62.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H26O2 |
|---|
| Molecular Mass | 250.1933 |
|---|
| SMILES | CC(C)(C)c1cc(CCO)cc(C(C)(C)C)c1O |
|---|
| InChI Key | BRZPJNCKIKTYBE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolshydrocarbon derivativesphenylpropanes |
|---|
| Substituents | phenylpropanealcoholaromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxygen compoundtyrosolhydrocarbon derivativeorganooxygen compound |
|---|
