| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:52 UTC |
|---|
| Update Date | 2025-03-21 18:04:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052494 |
|---|
| Frequency | 62.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H5Cl2NO3S |
|---|
| Molecular Mass | 240.9367 |
|---|
| SMILES | NS(=O)(=O)Oc1ccc(Cl)cc1Cl |
|---|
| InChI Key | RTSZYSFIADLVLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chlorideshydrocarbon derivativesorganic nitrogen compoundsorganic oxidesorganic sulfuric acids and derivativesorganochloridesorganooxygen compoundsphenoxy compounds |
|---|
| Substituents | aryl chlorideorganic sulfuric acid or derivativesorganochlorideorganohalogen compoundaryl halide1,3-dichlorobenzenearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
