| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:55:55 UTC |
|---|
| Update Date | 2025-03-21 18:04:45 UTC |
|---|
| HMDB ID | HMDB0034051 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052589 |
|---|
| Name | 6-Galloylglucose |
|---|
| Frequency | 61.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16O10 |
|---|
| Molecular Mass | 332.0743 |
|---|
| SMILES | O=C(OCC1OC(O)C(O)C(O)C1O)c1cc(O)c(O)c(O)c1 |
|---|
| InChI Key | VGVDLJNNDOFWKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-hydroxybenzoic acid esters |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoyl derivativescarboxylic acid estershemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyrogallols and derivativessecondary alcoholsp-hydroxybenzoic acid alkyl esters |
|---|
| Substituents | aromatic heteromonocyclic compoundp-hydroxybenzoic acid esterbenzoyl1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativesaccharideorganic oxidehemiacetaloxanem-hydroxybenzoic acid esterorganoheterocyclic compoundalcoholpyrogallol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidp-hydroxybenzoic acid alkyl esteroxacyclemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholphenolhydrocarbon derivativeorganooxygen compound |
|---|