| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:56 UTC |
|---|
| Update Date | 2025-03-21 18:04:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052647 |
|---|
| Frequency | 90.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11NO4S |
|---|
| Molecular Mass | 229.0409 |
|---|
| SMILES | O=S(=O)(O)N=C(O)CCc1ccccc1 |
|---|
| InChI Key | XTDOAOMUCVIMNL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyorganic oxideorganic sulfuric acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|