| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:57 UTC |
|---|
| Update Date | 2025-03-21 18:04:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052666 |
|---|
| Frequency | 61.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H10O8 |
|---|
| Molecular Mass | 210.0376 |
|---|
| SMILES | O=C(O)C1OC(OO)C(O)C(O)C1O |
|---|
| InChI Key | NMQJAYMCAVCANL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl hydroperoxidesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesperoxolspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | carbonyl groupcarboxylic acidglucuronic acid or derivativesmonosaccharidehydroperoxidecarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidorganic oxidealkyl hydroperoxidealiphatic heteromonocyclic compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidperoxoloxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivative |
|---|
