DeepMet

Record Information
HMDB Status	expected
Creation Date	2024-02-20 23:55:57 UTC
Update Date	2025-03-21 18:04:47 UTC
HMDB ID	HMDB0240491
Metabolite Identification
DeepMet ID	DMID00052690
Name	Curcumin glucuronide
Frequency	61.7
Structure
Chemical Formula	C₂₇H₂₈O₁₂
Molecular Mass	544.1581
SMILES	COc1cc(C=CC(=O)CC(=O)C=Cc2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)c(OC)c2)ccc1O
InChI Key	BNSAVBGHRVFVNN-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	phenylpropanoids and polyketides
Class	diarylheptanoids
Subclass	linear diarylheptanoids
Direct Parent	curcuminoids
Geometric Descriptor	aromatic heteromonocyclic compounds
Alternative Parents	1-hydroxy-2-unsubstituted benzenoids acetals acryloyl compounds alkyl aryl ethers anisoles beta hydroxy acids and derivatives carboxylic acids enones glucuronic acid derivatives hydrocarbon derivatives hydroxycinnamic acids ketones methoxybenzenes methoxyphenols monocarboxylic acids and derivatives monosaccharides o-glucuronides organic oxides oxacyclic compounds oxanes phenoxy compounds pyran carboxylic acids secondary alcohols
Substituents	phenol ether monocyclic benzene moiety carbonyl group ether carboxylic acid glucuronic acid or derivatives aromatic heteromonocyclic compound o-glucuronide 1-hydroxy-2-unsubstituted benzenoid methoxyphenol monosaccharide alkyl aryl ether alpha,beta-unsaturated ketone carboxylic acid derivative pyran carboxylic acid hydroxycinnamic acid or derivatives ketone 1-o-glucuronide cinnamic acid or derivatives beta-hydroxy acid saccharide organic oxide acetal curcumin oxane organoheterocyclic compound enone alcohol pyran carboxylic acid or derivatives hydroxy acid methoxybenzene hydroxycinnamic acid oxacycle monocarboxylic acid or derivatives organic oxygen compound pyran anisole secondary alcohol phenol hydrocarbon derivative benzenoid acryloyl-group phenoxy compound organooxygen compound

Showing information for DMID00052690