| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:55:58 UTC |
|---|
| Update Date | 2025-03-21 18:04:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052716 |
|---|
| Frequency | 61.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H25N7O6 |
|---|
| Molecular Mass | 471.1866 |
|---|
| SMILES | Nc1nc2c(c(=O)[nH]1)N1CCN(c3ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc3)CC1CN2 |
|---|
| InChI Key | MNEFBZMEOHOHKX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidsaminobenzamidesaniline and substituted anilinesazacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acidsdialkylarylaminesdicarboxylic acids and derivativesheteroaromatic compoundshippuric acids and derivativeshydrocarbon derivativesimidolactamslactamsn-acyl-alpha amino acidsn-arylpiperazinesorganic oxidesorganopnictogen compoundsphenylpiperazinesprimary aminespterins and derivativespyrimidonessecondary alkylarylaminessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | monocyclic benzene moietylactamcarboxylic acidbenzoylorganonitrogen compoundalpha-amino acidaminobenzoic acid or derivativesorganoheterocyclic compoundn-acyl-alpha amino acid or derivativesvinylogous amidepterinazacyclen-acyl-alpha-amino acidheteroaromatic compoundglutamic acid or derivativessecondary aliphatic/aromatic aminephenylpiperazinesecondary carboxylic acid amidedicarboxylic acid or derivativeshydrocarbon derivativeprimary amineaminecarbonyl groupamino acidpyrimidonebenzamidepyrimidineorganic oxidepiperazinearomatic heteropolycyclic compoundtertiary aliphatic/aromatic amineorganopnictogen compounddialkylarylamineimidolactamtertiary aminehippuric acid or derivativesaniline or substituted anilinesbenzoic acid or derivativessecondary aminecarboxamide groupaminobenzamideorganic oxygen compound1,4-diazinanebenzenoidorganic nitrogen compoundn-arylpiperazineorganooxygen compound |
|---|