| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:05 UTC |
|---|
| Update Date | 2025-03-21 18:04:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052972 |
|---|
| Frequency | 61.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6O7S2 |
|---|
| Molecular Mass | 253.9555 |
|---|
| SMILES | O=S(=O)(O)Oc1ccccc1S(=O)(=O)O |
|---|
| InChI Key | WBBWDUVPBOXKJM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-sulfo,2-unsubstituted aromatic compoundsarylsulfonic acids and derivativesbenzenesulfonic acids and derivativesbenzenesulfonyl compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidsphenoxy compoundssulfonylssulfuric acid monoesters |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietysulfuric acid monoester1-sulfo,2-unsubstituted aromatic compoundorganosulfonic acidbenzenesulfonateorganosulfur compoundaromatic homomonocyclic compoundphenylsulfateorganic oxidesulfonylarylsulfonic acid or derivativesorganic oxygen compoundorganic sulfonic acid or derivativessulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compoundbenzenesulfonyl group |
|---|
