| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:56:06 UTC |
|---|
| Update Date | 2025-03-21 18:04:49 UTC |
|---|
| HMDB ID | HMDB0001125 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00052996 |
|---|
| Name | Inositol cyclic phosphate |
|---|
| Frequency | 61.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H11O8P |
|---|
| Molecular Mass | 242.0192 |
|---|
| SMILES | O=P1(O)OC2C(O)C(O)C(O)C(O)C2O1 |
|---|
| InChI Key | SXHMVNXROAUURW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativesdioxaphospholaneshydrocarbon derivativesorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcohol1,3_dioxaphospholanecyclitol or derivativescyclic alcoholaliphatic heteropolycyclic compoundoxacycleorganic oxideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
