| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:08 UTC |
|---|
| Update Date | 2025-03-21 18:04:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00053080 |
|---|
| Frequency | 61.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O6 |
|---|
| Molecular Mass | 302.079 |
|---|
| SMILES | COc1cc(O)cc2c1C(=O)CC(c1ccc(O)c(O)c1)O2 |
|---|
| InChI Key | RMJKSMSYIZHFCO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 5-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersanisolesaryl alkyl ketonesbenzene and substituted derivativeschromonesflavanoneshydrocarbon derivativesorganic oxidesoxacyclic compounds |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanoneflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidechromonearomatic heteropolycyclic compound5-methoxyflavonoid-skeletonchromaneorganoheterocyclic compoundbenzopyran1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compoundanisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|