| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:15 UTC |
|---|
| Update Date | 2025-03-21 18:04:53 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00053336 |
|---|
| Frequency | 68.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8F3N5S |
|---|
| Molecular Mass | 263.0453 |
|---|
| SMILES | Nc1nc(SCCC(F)(F)F)nc2nc[nH]c12 |
|---|
| InChI Key | DJVUEBRHWZUISG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalkylarylthioethersazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsorganofluoridesorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivativessulfenyl compounds |
|---|
| Substituents | alkylarylthioetherorganosulfur compoundorganohalogen compoundaryl thioetherpyrimidinearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundalkyl halideimidolactamazolesulfenyl compoundazacyclealkyl fluorideorganofluorideheteroaromatic compoundthioetherhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamine |
|---|
