| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:20 UTC |
|---|
| Update Date | 2025-03-21 18:04:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00053518 |
|---|
| Frequency | 60.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11NO2 |
|---|
| Molecular Mass | 225.079 |
|---|
| SMILES | NC(=O)c1cccc(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | FYJUZWSEPGGAOS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl ketonesaryl-phenylketonesbenzamidesbenzoyl derivativescarboxylic acids and derivativesdiphenylmethaneshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidediphenylmethanearyl-phenylketonebenzoylbenzoic acid or derivativescarboxamide groupcarboxylic acid derivativebenzamidebenzophenoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundaryl ketone |
|---|
