| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:27 UTC |
|---|
| Update Date | 2025-03-21 18:04:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00053787 |
|---|
| Frequency | 60.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O7 |
|---|
| Molecular Mass | 316.0583 |
|---|
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(O)cc3o2)c(O)cc1O |
|---|
| InChI Key | BRNLWLRARQAPRJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 3'-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids4-alkoxyphenols5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersanisoleschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivativesresorcinolsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyranmethoxyphenol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherresorcinolorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compound4-alkoxyphenolbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidmethoxybenzene3p-methoxyflavonoid-skeletonoxacyclevinylogous acidorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|