| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:28 UTC |
|---|
| Update Date | 2025-03-21 18:04:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00053831 |
|---|
| Frequency | 60.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16NO2S+ |
|---|
| Molecular Mass | 250.0896 |
|---|
| SMILES | Cc1c(CCO)sc[n+]1Cc1ccccc1O |
|---|
| InChI Key | BYFILZMMGZYTQI-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | azoles |
|---|
| Subclass | thiazoles |
|---|
| Direct Parent | 4,5-disubstituted thiazoles |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalcohols and polyolsazacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compoundazacycleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoid4,5-disubstituted 1,3-thiazoleorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganic cationorganooxygen compound |
|---|