| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:29 UTC |
|---|
| Update Date | 2025-03-21 18:04:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00053861 |
|---|
| Frequency | 60.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13N2O9P |
|---|
| Molecular Mass | 312.0359 |
|---|
| SMILES | O=C1CN(C2OC(COP(=O)(O)O)C(O)C2O)C(=O)N1 |
|---|
| InChI Key | KGTLEDAZDQWALN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha amino acidsazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdicarboximideshydantoinshydrocarbon derivativesimidazolidinonesmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | imidazolidinecarbonyl grouppentose phosphatepentose-5-phosphatealpha-amino acid or derivativescarboxylic acid derivativeimidazolidinoneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganoheterocyclic compound1,2-diolalcoholcarbonic acid derivativeazacycletetrahydrofuranoxacyclephosphoric acid esterhydantoinmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
