| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:30 UTC |
|---|
| Update Date | 2025-03-21 18:04:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00053883 |
|---|
| Frequency | 59.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O6S |
|---|
| Molecular Mass | 217.9885 |
|---|
| SMILES | O=C(Oc1ccccc1)OS(=O)(=O)O |
|---|
| InChI Key | DXLZBIYGEZWULL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxy compounds |
|---|
| Direct Parent | phenoxy compounds |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesorganic carbonic acids and derivativesorganic oxidessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoestercarbonyl groupcarbonic acid derivativeorganic sulfuric acid or derivativesaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundhydrocarbon derivativephenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
