| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:34 UTC |
|---|
| Update Date | 2025-03-21 18:05:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054041 |
|---|
| Frequency | 59.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H9F5O2 |
|---|
| Molecular Mass | 268.0523 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(F)(F)C(F)(F)F)cc1 |
|---|
| InChI Key | HHGGUEYLBMYBPG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesaromatic monoterpenoidsbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesorganofluorides |
|---|
| Substituents | monoterpenoidmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidalkyl fluorideorganofluoridep-cymenecarboxylic acid derivativeorganohalogen compoundaromatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidalkyl halidehydrocarbon derivativebenzenoidorganooxygen compoundaromatic monoterpenoid |
|---|