| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:36 UTC |
|---|
| Update Date | 2025-03-21 18:05:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054121 |
|---|
| Frequency | 59.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C27H43NO5 |
|---|
| Molecular Mass | 461.3141 |
|---|
| SMILES | CC12CCC(O)C(C)(C)C1CCC1=C2CCC2(C)C1CCC2C(O)CCC(=O)NCC(=O)O |
|---|
| InChI Key | GIVMWPRSXRZRTH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | androstane steroids |
|---|
| Direct Parent | androgens and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-hydroxysteroidsacyl glycinesalpha amino acidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativesditerpenoidshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | 20-hydroxysteroidfatty acylcarbonyl groupcarboxylic acidandrogen-skeletonabietane diterpenoidfatty amidealpha-amino acid or derivativescarboxylic acid derivativealiphatic homopolycyclic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesalcoholn-acyl-alpha-amino acid3-hydroxysteroidhydroxysteroidcyclic alcoholcarboxamide groupn-acyl-aminen-acylglycinesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundditerpenoidorganooxygen compound |
|---|
