| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:37 UTC |
|---|
| Update Date | 2025-03-21 18:05:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054178 |
|---|
| Frequency | 59.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18N2O2 |
|---|
| Molecular Mass | 222.1368 |
|---|
| SMILES | CC(N)C(=O)NC(C)C(O)c1ccccc1 |
|---|
| InChI Key | LKUOWMWHBQIPSP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alanine and derivativesalpha amino acidsaromatic alcoholscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylpropanessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | aromatic alcoholalcoholmonocyclic benzene moietycarbonyl groupalpha-amino acid amidecarboxamide groupphenylpropanearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundalpha-amino acidsecondary alcoholorganopnictogen compoundalanine or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|