| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:39 UTC |
|---|
| Update Date | 2025-03-21 18:05:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054226 |
|---|
| Frequency | 59.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O6 |
|---|
| Molecular Mass | 276.0634 |
|---|
| SMILES | COc1cc(C(=O)c2c(O)cc(O)cc2O)ccc1O |
|---|
| InChI Key | IUJRMJDXGWDPID-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersanisolesaryl ketonesaryl-phenylketonesbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundsphloroglucinols and derivativesvinylogous acids |
|---|
| Substituents | diphenylmethanephenol etheretherbenzoyl1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherbenzophenoneketonephloroglucinol derivativeorganic oxidebenzenetriolaryl-phenylketone1-hydroxy-4-unsubstituted benzenoidmethoxybenzenearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativephenoxy compoundorganooxygen compoundaryl ketone |
|---|
