| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:39 UTC |
|---|
| Update Date | 2025-03-21 18:05:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054228 |
|---|
| Frequency | 59.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N5O2S |
|---|
| Molecular Mass | 253.0633 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1CSC(CO)O1 |
|---|
| InChI Key | GOIOKJULSNLSBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsmonothioacetalsn-substituted imidazolesorganopnictogen compoundsoxacyclic compoundsoxathiolanesprimary alcoholsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | oxathiolanepyrimidinemonothioacetalaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundprimary alcoholimidolactamazolen-substituted imidazolealcoholazacycleheteroaromatic compoundoxacycleorganic oxygen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundamineorganooxygen compound |
|---|
