| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:56:43 UTC |
|---|
| Update Date | 2025-03-21 18:05:03 UTC |
|---|
| HMDB ID | HMDB0039430 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054395 |
|---|
| Name | 9,10-Dihydro-2,3,5,7-Phenanthrenetetrol |
|---|
| Frequency | 59.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O4 |
|---|
| Molecular Mass | 244.0736 |
|---|
| SMILES | Oc1cc(O)c2c(c1)CCc1cc(O)c(O)cc1-2 |
|---|
| InChI Key | NIGUICNPKCJLJQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesnaphthols and derivativesorganooxygen compounds |
|---|
| Substituents | phenanthrenenaphthaleneorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundhydrocarbon derivative1-hydroxy-4-unsubstituted benzenoid2-naphtholorganooxygen compound |
|---|
