| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:46 UTC |
|---|
| Update Date | 2025-03-21 18:05:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054506 |
|---|
| Frequency | 94.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O8PS |
|---|
| Molecular Mass | 276.0069 |
|---|
| SMILES | OC1C(O)C(O)C(OP(O)(O)=S)C(O)C1O |
|---|
| InChI Key | NMRTXVUJNGNXSX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | cyclitols and derivativeshydrocarbon derivativesthiophosphate monoesters |
|---|
| Substituents | thiophosphoric acid estercyclohexanolcyclitol or derivativescyclic alcoholthiophosphate monoesterorganic thiophosphoric acid or derivativesaliphatic homomonocyclic compoundhydrocarbon derivative |
|---|
