| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:56:54 UTC |
|---|
| Update Date | 2025-03-21 18:05:06 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00054810 |
|---|
| Frequency | 58.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H27NO2 |
|---|
| Molecular Mass | 325.2042 |
|---|
| SMILES | CCCCCCCCc1ccc(Nc2cccc(C(=O)O)c2)cc1 |
|---|
| InChI Key | XPEOMABWLNZEEC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundssecondary amines |
|---|
| Substituents | carboxylic acidamino acid or derivativesamino acidbenzoylsecondary aminecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundbenzoic acidorganooxygen compoundamine |
|---|
