| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:56:59 UTC |
|---|
| Update Date | 2025-03-21 18:05:08 UTC |
|---|
| HMDB ID | HMDB0028987 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055008 |
|---|
| Name | Methionyl-Gamma-glutamate |
|---|
| Frequency | 68.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H19N3O4S |
|---|
| Molecular Mass | 277.1096 |
|---|
| SMILES | CSCCC(N)C(=O)NC(=O)CCC(N)C(=O)O |
|---|
| InChI Key | YVSZXQHOADMOLO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidscarbonyl compoundscarboxylic acidsdialkylthioethersdicarboximidesfatty acids and conjugateshydrocarbon derivativesmethionine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssulfenyl compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidglutamine or derivativesfatty acidorganosulfur compoundcarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximidesulfenyl compoundalpha-amino acid amidedialkylthioethern-acyl-aminecarboxylic acid imidemonocarboxylic acid or derivativesorganic oxygen compoundthioethermethionine or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
