| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:01 UTC |
|---|
| Update Date | 2025-03-21 18:05:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055101 |
|---|
| Frequency | 58.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H6Cl2O6P2 |
|---|
| Molecular Mass | 257.9017 |
|---|
| SMILES | COP(=O)(O)C(Cl)(Cl)P(=O)(O)O |
|---|
| InChI Key | NNZZDHWCSXHGNK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphonic acids and derivatives |
|---|
| Subclass | bisphosphonates |
|---|
| Direct Parent | bisphosphonates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl chlorideshydrocarbon derivativesorganic oxidesorganochloridesorganooxygen compoundsorganophosphorus compoundsorganopnictogen compoundsphosphonic acid esters |
|---|
| Substituents | aliphatic acyclic compoundbisphosphonatealkyl chlorideorganochlorideorganohalogen compoundphosphonic acid esterorganic oxideorganic oxygen compoundorganopnictogen compoundorganophosphorus compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
