| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:04 UTC |
|---|
| Update Date | 2025-03-21 18:05:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055203 |
|---|
| Frequency | 58.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H20O12 |
|---|
| Molecular Mass | 476.0955 |
|---|
| SMILES | O=C1CC(c2ccc(OC3OC(C(=O)O)C(C(=O)O)C(O)C3O)cc2)Oc2cc(O)cc(O)c21 |
|---|
| InChI Key | MSNZGXYGGBUPRV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-hydroxyflavonoids7-hydroxyflavonoidsacetalsalkyl aryl ethersaryl alkyl ketonesbeta hydroxy acids and derivativescarboxylic acidschromonesdicarboxylic acids and derivativesflavanonesglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketone1-benzopyranflavanonemonosaccharidepyran carboxylic acidketonebeta-hydroxy acidsaccharideacetalchromoneoxaneorganoheterocyclic compound1,2-diolalcoholbenzopyran5-hydroxyflavonoidvinylogous acid7-hydroxyflavonoiddicarboxylic acid or derivativeshydrocarbon derivativephenoxy compoundaryl ketonecarbonyl groupetherglucuronic acid or derivativesflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundchromanepyran carboxylic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidflavonoid-4p-o-glucuronideoxacycleorganic oxygen compoundpyransecondary alcoholbenzenoidorganooxygen compound |
|---|