| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:04 UTC |
|---|
| Update Date | 2025-03-21 18:05:10 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055209 |
|---|
| Frequency | 58.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O5 |
|---|
| Molecular Mass | 298.0841 |
|---|
| SMILES | O=C(O)CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1 |
|---|
| InChI Key | QMEIGTKPEVWIBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acidsdicarboxylic acids and derivativesdiphenylmethaneshydrocarbon derivativesorganic oxidesphenylpropanoic acids |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acid3-phenylpropanoic-acidaryl-phenylketonebenzoylcarboxylic acid derivativebenzophenoneketonearomatic homomonocyclic compoundorganic oxideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|