| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:07 UTC |
|---|
| Update Date | 2025-03-21 18:05:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055324 |
|---|
| Frequency | 57.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H6I2O3 |
|---|
| Molecular Mass | 415.8406 |
|---|
| SMILES | O=C(O)C=Cc1cc(I)c(O)c(I)c1 |
|---|
| InChI Key | WTIKMBSLXNHSGL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | hydroxycinnamic acids and derivatives |
|---|
| Direct Parent | hydroxycinnamic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl iodidescarbonyl compoundscarboxylic acidshalophenolshydrocarbon derivativesiodobenzenesmonocarboxylic acids and derivativeso-iodophenolsorganic oxidesorganoiodides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid2-iodophenolcarboxylic acid derivativeorganohalogen compoundiodobenzenehydroxycinnamic acidorganoiodidearyl halidearomatic homomonocyclic compound2-halophenolorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidaryl iodidehalobenzeneorganooxygen compound |
|---|
