| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:57:07 UTC |
|---|
| Update Date | 2025-03-21 18:05:11 UTC |
|---|
| HMDB ID | HMDB0000767 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055334 |
|---|
| Name | Pseudouridine |
|---|
| Frequency | 135.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N2O6 |
|---|
| Molecular Mass | 244.0695 |
|---|
| SMILES | O=c1nc(O)c(C2OC(CO)C(O)C2O)c[nH]1 |
|---|
| InChI Key | PTJWIQPHWPFNBW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdialkyl ethersheteroaromatic compoundshydrocarbon derivativeshydroxypyrimidinesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | etheraromatic heteromonocyclic compoundmonosaccharidepyrimidonehydroxypyrimidinedialkyl ethersaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholalcoholcarbonic acid derivativeazacycletetrahydrofuranheteroaromatic compoundoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
