| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:07 UTC |
|---|
| Update Date | 2025-03-21 18:05:11 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055349 |
|---|
| Frequency | 57.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O3 |
|---|
| Molecular Mass | 252.0786 |
|---|
| SMILES | Oc1ccc(-c2cc3cc(O)ccc3cc2O)cc1 |
|---|
| InChI Key | LWFALFHAKFJCMR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | phenylnaphthalenes |
|---|
| Direct Parent | phenylnaphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativeshydrocarbon derivativesnaphthols and derivativesorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietyorganic oxygen compoundphenylnaphthalene1-hydroxy-2-unsubstituted benzenoidphenolaromatic homopolycyclic compoundhydrocarbon derivative2-naphtholorganooxygen compound |
|---|
