| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:10 UTC |
|---|
| Update Date | 2025-03-21 18:05:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055445 |
|---|
| Frequency | 57.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10O5 |
|---|
| Molecular Mass | 246.0528 |
|---|
| SMILES | O=C(c1ccccc1O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | BVWMFYUCIIBBGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl ketonesaryl-phenylketonesbenzoyl derivativesdiphenylmethaneshydrocarbon derivativesorganic oxidesorganooxygen compoundsphloroglucinols and derivativesvinylogous acids |
|---|
| Substituents | diphenylmethanebenzenetriolaryl-phenylketonebenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidbenzophenoneketonephloroglucinol derivativearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundphenolhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|