| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:15 UTC |
|---|
| Update Date | 2025-03-21 18:05:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055619 |
|---|
| Frequency | 57.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14N3O8P |
|---|
| Molecular Mass | 323.0519 |
|---|
| SMILES | Nc1ccn(C2C(O)C(O)C(OP(=O)(O)O)C2O)c(=O)n1 |
|---|
| InChI Key | WCSWBJNXUSJREP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclitols and derivativescyclopentanolsheteroaromatic compoundshydrocarbon derivativesimidolactamsmonoalkyl phosphatesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminespyrimidones |
|---|
| Substituents | aromatic heteromonocyclic compoundpyrimidonepyrimidineorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compoundcyclopentyl nucleosidealcoholcarbonic acid derivativeazacycleheteroaromatic compoundcyclitol or derivativescyclic alcoholcyclopentanolorganic oxygen compoundphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|
