| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:15 UTC |
|---|
| Update Date | 2025-03-21 18:05:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055625 |
|---|
| Frequency | 57.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18O7 |
|---|
| Molecular Mass | 346.1053 |
|---|
| SMILES | Oc1ccc(C2OCC3C(c4cc(O)c(O)c(O)c4)OCC23)cc1O |
|---|
| InChI Key | YUZGPDHHZODDAB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | furanoid lignans |
|---|
| Subclass | furan lignans |
|---|
| Direct Parent | furan lignans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativesdialkyl ethersfurofuran lignansfurofuranshydrocarbon derivativesoxacyclic compoundspyrogallols and derivativestetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietyetherpyrogallol derivativefurofuran lignan skeletontetrahydrofuranbenzenetriol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoiddialkyl etheroxacyclefuran lignan skeletonorganic oxygen compoundaromatic heteropolycyclic compoundfurofuranphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
