| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:15 UTC |
|---|
| Update Date | 2025-03-21 18:05:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055650 |
|---|
| Frequency | 68.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15NO4 |
|---|
| Molecular Mass | 285.1001 |
|---|
| SMILES | O=C(O)CNC(=O)C(O)(c1ccccc1)c1ccccc1 |
|---|
| InChI Key | XSVTXNPDCWSNSM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaromatic alcoholscarbonyl compoundscarboxylic acidsdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamidessecondary carboxylic acid amidestertiary alcohols |
|---|
| Substituents | aromatic alcoholdiphenylmethanemonocyclic benzene moietycarbonyl groupcarboxylic acidorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundphenylacetamidealcoholcarboxamide groupn-acylglycinearomatic homomonocyclic compoundsecondary carboxylic acid amidetertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
