| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:15 UTC |
|---|
| Update Date | 2025-03-21 18:05:14 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055655 |
|---|
| Frequency | 57.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H14O12P2 |
|---|
| Molecular Mass | 339.996 |
|---|
| SMILES | O=C(O)C(COP(=O)(O)O)OP(=O)(O)OCC(O)CO |
|---|
| InChI Key | WDFMJNRRKCBRIE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | sugar acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativedialkyl phosphateorganic oxidemonocarboxylic acid or derivativesphosphoric acid esterglyceric_acidmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary alcoholorganic phosphoric acid derivativealkyl phosphate1,2-diol |
|---|
