| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:17 UTC |
|---|
| Update Date | 2025-03-21 18:05:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055736 |
|---|
| Frequency | 57.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N3O3 |
|---|
| Molecular Mass | 209.08 |
|---|
| SMILES | Nc1ccn(C2C=CC(O)C2O)c(=O)n1 |
|---|
| InChI Key | AVJYOQPJIYCTMS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary alcohols |
|---|
| Substituents | alcoholcarbonic acid derivativearomatic heteromonocyclic compoundazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganoheterocyclic compoundorganooxygen compound1,2-diolcyclopentyl nucleoside |
|---|