| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:21 UTC |
|---|
| Update Date | 2025-03-21 18:05:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00055889 |
|---|
| Frequency | 57.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H13NO3 |
|---|
| Molecular Mass | 243.0895 |
|---|
| SMILES | O=C(O)CNC(=O)Cc1cccc2ccccc12 |
|---|
| InChI Key | BMZHJBUIQBHUPO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupcarboxylic acidaromatic homopolycyclic compoundcarboxamide groupn-acylglycinesecondary carboxylic acid amideorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|