| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:57:25 UTC |
|---|
| Update Date | 2025-03-21 18:05:17 UTC |
|---|
| HMDB ID | HMDB0257458 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056019 |
|---|
| Name | Salicylamide glucuronide |
|---|
| Frequency | 57.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15NO8 |
|---|
| Molecular Mass | 313.0798 |
|---|
| SMILES | NC(=O)c1ccccc1OC1OC(C(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | AEMUKQHDNNVAES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbenzamidesbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary carboxylic acid amidespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | primary carboxylic acid amidephenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundbenzoylo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidbenzamide1-o-glucuronidebeta-hydroxy acidorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativesbenzoic acid or derivativeshydroxy acidcarboxamide groupoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|
