| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:27 UTC |
|---|
| Update Date | 2025-03-21 18:05:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056119 |
|---|
| Frequency | 56.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H6Cl2O3 |
|---|
| Molecular Mass | 219.9694 |
|---|
| SMILES | O=C(O)Cc1cc(Cl)c(O)c(Cl)c1 |
|---|
| InChI Key | WKGVWIDAQMUITK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | dichlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboxylic acidshalophenolshydrocarbon derivativesmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochlorides |
|---|
| Substituents | aryl chloride2-chlorophenolcarbonyl groupcarboxylic acidorganochloridecarboxylic acid derivativeorganohalogen compoundaryl halide1,3-dichlorobenzenearomatic homomonocyclic compound2-halophenolorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeorganooxygen compound |
|---|
