| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:29 UTC |
|---|
| Update Date | 2025-03-21 18:05:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056174 |
|---|
| Frequency | 56.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H10N2 |
|---|
| Molecular Mass | 182.0844 |
|---|
| SMILES | Cc1cc2c(cn1)[nH]c1ccccc12 |
|---|
| InChI Key | XOHBPUCYRSORIZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | pyridoindoles |
|---|
| Direct Parent | beta carbolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivativespyrroles |
|---|
| Substituents | azacycleindolepolyhalopyridineheteroaromatic compoundpyridinearomatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundbeta-carbolinehydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compound |
|---|
