| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:57:33 UTC |
|---|
| Update Date | 2025-03-21 18:05:20 UTC |
|---|
| HMDB ID | HMDB0030802 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056338 |
|---|
| Name | Patuletin |
|---|
| Frequency | 56.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O8 |
|---|
| Molecular Mass | 332.0532 |
|---|
| SMILES | COc1c(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c2c1O |
|---|
| InChI Key | JMIFIYIEXODVTO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-hydroxyflavonoids4'-hydroxyflavonoids5-hydroxyflavonoids6-o-methylated flavonoids7-hydroxyflavonoidsalkyl aryl ethersanisolesbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous acids |
|---|
| Substituents | 3-hydroxyflavonephenol ethermonocyclic benzene moiety3-hydroxyflavonoidether1-benzopyran6-methoxyflavonoid-skeleton1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compoundpyrananisole7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|