| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:35 UTC |
|---|
| Update Date | 2025-03-21 18:05:20 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056397 |
|---|
| Frequency | 56.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H19NO5 |
|---|
| Molecular Mass | 221.1263 |
|---|
| SMILES | CC(C)(CO)C(O)C(=O)NCC(O)CO |
|---|
| InChI Key | CVRXMTFSVLVUKS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty amides |
|---|
| Direct Parent | n-acyl amines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupmonosaccharidecarboxamide groupcarboxylic acid derivativen-acyl-aminesecondary carboxylic acid amidesaccharideorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundprimary alcoholorganooxygen compound |
|---|
