| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:57:37 UTC |
|---|
| Update Date | 2025-03-21 18:05:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00056490 |
|---|
| Frequency | 56.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13N5O3S3 |
|---|
| Molecular Mass | 323.0181 |
|---|
| SMILES | NC(CCSCc1csc(NC=O)n1)=NS(N)(=O)=O |
|---|
| InChI Key | JQZRITKBZSXXJR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-arylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,4-disubstituted thiazolesamidinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundn-arylamideamidineorganosulfur compoundcarboxylic acid derivativeorganic oxideorganopnictogen compoundorganoheterocyclic compoundazoleorganic sulfuric acid or derivativessulfenyl compoundazacycledialkylthioetherheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundthioether2,4-disubstituted 1,3-thiazolehydrocarbon derivativethiazoleorganooxygen compound |
|---|
